Useful Links & Tools
- Bulk Quote-Order Product
- MSDS
- Specification Sheet
- Certificate of Analysis
- Certificate of Origin
| FT-IR Raman | ![]() |
| Structure Search |
| Pressure-Temperature Nomograph |
W250902
Geranyl acetate
FCC, FG
| Synonym: | trans-3,7-Dimethyl-2,6-octadien-1-yl acetate, trans-3,7-Dimethyl-2,6-octadienyl acetate |
| CAS Number: | 105-87-3 |
| Linear Formula: | CH3CO2CH2CH=C(CH3)CH2CH2CH=C(CH3)2 |
| Molecular Weight: | 196.29 |
| FEMA Number: | 2509 |
| EC Number: | 203-341-5 |
| Council of Europe no.: | 201 |
| MDL number: | MFCD00015037 |
| PubChem Substance ID: | 24900977 |
| Flavis number: | 9.011 |
Properties
| grade | FCC |
| FG | |
| Halal | |
| Kosher | |
| NI | |
| vapor density | 6.8 (vs air) |
| vapor pressure | 0.07 mmHg ( 20 °C) |
| refractive index | n |
| bp | 138 °C/25 mmHg(lit.) |
| Organoleptic | fruity; floral; rose; sweet |
Safety
| Personal Protective Equipment | Faceshields, full-face respirator (US), Gloves, Goggles, multi-purpose combination respirator cartridge (US), type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 1 |
| RTECS | RG5920000 |
| Flash Point(F) | 220 °F |
| Flash Point(C) | 104 °C |
References
| Beilstein | Beil. 2,140 |
| reference | Arctander, 1430 / FT-IR 2 (1), 1015:A / FT-NMR 1 (1), 968:B / Fenaroli, 295 / RegBook 30 (1), 717:G / RegBook 1 (1), 717:G / Sax 6, 1184 / Structure Index 1, 109:A:3 |



















